For research use only. Not for therapeutic Use.
Deg-1 is a a bifunctional probe with a cleavage group and a covalent binding group. Deg-1 covalently binds to the target nucleic acid, and serves as click-degrader to cleave a nucleic acid molecule. Deg-1 has potential to selectively cleave target nucleic acids in cells[1].
| Catalog Number | I041081 |
| CAS Number | 2761446-55-1 |
| Synonyms | 1-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]imidazole |
| Molecular Formula | C15H27N5O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H27N5O5/c16-19-18-2-5-21-7-9-23-11-13-25-14-12-24-10-8-22-6-4-20-3-1-17-15-20/h1,3,15H,2,4-14H2 |
| InChIKey | INBZJGUSXQXYEH-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| Reference | [1]. Bernardes G, et al. Method for targeted nucleic acid cleavage. World Intellectual Property Organization, WO2022034177 A1 2022-02-17. |
