For research use only. Not for therapeutic Use.
Dehydrocorydaline nitrate (Cat.No:R072469) is a chemical compound derived from the alkaloid dehydrocorydaline, found in various plant species, including the Chinese herb Corydalis yanhusuo. It has been studied for its potential pharmacological effects, such as anti-inflammatory and analgesic properties.
CAS Number | 13005-09-9 |
Molecular Formula | C22H24N2O7 |
Purity | ≥95% |
Target | Cell Cycle/DNA Damage |
Storage | Hygroscopic, -20°C Freezer, Under inert atmosphere |
IUPAC Name | 2,3,9,10-tetramethoxy-13-methyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;nitrate |
InChI | InChI=1S/C22H24NO4.NO3/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23;2-1(3)4/h6-7,10-12H,8-9H2,1-5H3;/q+1;-1 |
InChIKey | CZZFYGAXGATDNG-UHFFFAOYSA-N |
SMILES | CC1=C2C=CC(=C(C2=C[N+]3=C1C4=CC(=C(C=C4CC3)OC)OC)OC)OC.[N+](=O)([O-])[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |