For research use only. Not for therapeutic Use.
Dehydrocorydaline (Cat.No:R065913) is an alkaloid compound derived from the Chinese herb Corydalis yanhusuo. It has been studied for its potential therapeutic properties, including anti-inflammatory and analgesic effects. Dehydrocorydaline’s mechanisms of action involve modulation of neurotransmitter receptors, making it a subject of interest in pain management and neurological research.
| Catalog Number | R065913 |
| CAS Number | 30045-16-0 |
| Molecular Formula | C22H24NO4 |
| Purity | ≥95% |
| Target | Epigenetics |
| Storage | Store at -20°C |
| IUPAC Name | 2,3,9,10-tetramethoxy-13-methyl-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| InChI | InChI=1S/C22H24NO4/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23/h6-7,10-12H,8-9H2,1-5H3/q+1 |
| InChIKey | RFKQJTRWODZPHF-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=C(C2=C[N+]3=C1C4=CC(=C(C=C4CC3)OC)OC)OC)OC |
