For research use only. Not for therapeutic Use.
Dehydrocrenatidine（Cat No.:R021608）is a bioactive alkaloid isolated from various plants, particularly Menispermum dauricum, known for its diverse pharmacological properties. It exhibits significant anti-inflammatory, analgesic, and antitumor activities, making it a subject of interest in medicinal research. Studies have shown that dehydrocrenatidine can inhibit the proliferation of cancer cells and induce apoptosis through various molecular mechanisms. Additionally, it has potential neuroprotective effects and may enhance cognitive function. Its multifaceted therapeutic properties position dehydrocrenatidine as a promising candidate for the development of new treatments in oncology and inflammatory conditions.
| Catalog Number | R021608 |
| CAS Number | 65236-62-6 |
| Molecular Formula | C15H14N2O2 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| IUPAC Name | 1-ethenyl-4,8-dimethoxy-9H-pyrido[3,4-b]indole |
| InChI | InChI=1S/C15H14N2O2/c1-4-10-15-13(12(19-3)8-16-10)9-6-5-7-11(18-2)14(9)17-15/h4-8,17H,1H2,2-3H3 |
| InChIKey | LDWBTKDUAXOZRB-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1NC3=C2C(=CN=C3C=C)OC |
