For research use only. Not for therapeutic Use.
Dehydroergosterol is a naturally occurring, fluorescent analog of cholesterol (ex/em = 324/375 nm) that mimics the properties of cholesterol in cell membranes. It is readily bound by cholesterol-binding proteins and has been used for real-time probing of the sterol environment and to elucidate intracellular sterol trafficking in living organisms.
| Catalog Number | R066624 |
| CAS Number | 516-85-8 |
| Synonyms | DHE;9,11-dehydro Ergosterol |
| Molecular Formula | C28H42O |
| Purity | ≥95% |
| Target | Liposome |
| Storage | -20°C |
| IUPAC Name | (3S,10S,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C28H42O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,14,18-20,22,24-25,29H,11-13,15-17H2,1-6H3/b8-7+/t19-,20+,22-,24+,25-,27-,28+/m0/s1 |
| InChIKey | QSVJYFLQYMVBDR-CMNOFMQQSA-N |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C1(CC=C3C2=CC=C4C3(CCC(C4)O)C)C |
| Reference | 1.McIntosh, A.L.,Atshaves, B.P.,Huang, H., et al. Fluorescence techniques using dehydroergosterol to study cholesterol trafficking. Lipids 43(12), 1185-1208 (2008). |
