For research use only. Not for therapeutic Use.
Dehydroleucodine (Cat.No:R066222) is a natural sesquiterpene lactone isolated from the Artemisia douglasiana plant. It has been studied for its potential anti-inflammatory, antioxidant, and anticancer properties. Dehydroleucodine shows promise in preclinical studies as a candidate for various therapeutic applications, including cancer treatment and inflammatory disorders.
| Catalog Number | R066222 |
| CAS Number | 36150-07-9 |
| Molecular Formula | C15H16O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | (3aS,9aS,9bS)-6,9-dimethyl-3-methylidene-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,7-dione |
| InChI | InChI=1S/C15H16O3/c1-7-4-5-10-9(3)15(17)18-14(10)13-8(2)6-11(16)12(7)13/h6,10,13-14H,3-5H2,1-2H3/t10-,13-,14-/m0/s1 |
| InChIKey | SKNVIAFTENCNGB-BPNCWPANSA-N |
| SMILES | CC1=C2C(C3C(CC1)C(=C)C(=O)O3)C(=CC2=O)C |
