For research use only. Not for therapeutic Use.
(+)-Dehydrovomifoliol(Cat No.:M088675) is a naturally occurring organic compound belonging to the terpenoids class, specifically a sesquiterpene. It is characterized by its complex molecular structure that includes multiple functional groups and a rigid ring system. This compound is typically derived from plant sources and is known for its involvement in plant defense mechanisms and signaling. Chemically, it exhibits interesting pharmacological properties which are subject to research in the fields of medicine and agriculture. The biological activities associated with (+)-Dehydrovomifoliol include antimicrobial and anti-inflammatory effects, making it a potential candidate for drug development and agricultural applications.
CAS Number | 15764-81-5 |
Molecular Formula | C13H18O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4S)-4-hydroxy-3,5,5-trimethyl-4-[(E)-3-oxobut-1-enyl]cyclohex-2-en-1-one |
InChI | InChI=1S/C13H18O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-7,16H,8H2,1-4H3/b6-5+/t13-/m1/s1 |
InChIKey | JJRYPZMXNLLZFH-URWSZGRFSA-N |
SMILES | CC1=CC(=O)CC(C1(C=CC(=O)C)O)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |