For research use only. Not for therapeutic Use.
Delphinidin 3-β-D-Glucoside is a flavonoid glycoside commonly found in various fruits and vegetables, contributing to their blue, purple, or red color. This compound is known for its antioxidant properties, playing a significant role in neutralizing free radicals and protecting cells from oxidative stress. It has been studied for its potential health benefits, including anti-inflammatory, anticancer, and cardiovascular protective effects. Delphinidin 3-β-D-Glucoside is frequently investigated in research related to metabolic diseases and aging.
Catalog Number | R010859 |
CAS Number | 6906-38-3 |
Synonyms | 3-(β-D-Glucopyranosyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-1-benzopyrylium Chloride; Delphinidin 3-O-Glucoside; Delphinidol 3-Glucoside; Delphinin; Mirtillin; |
Molecular Formula | C21H21ClO12 |
Purity | ≥95% |
Target | Protein Tyrosine Kinase/RTK |
Storage | -20°C |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol;chloride |
InChI | InChI=1S/C21H20O12.ClH/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7;/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27);1H/t15-,17-,18+,19-,21-;/m1./s1 |
InChIKey | ZJWIIMLSNZOCBP-BTTVDUMLSA-N |
SMILES | C1=C(C=C(C(=C1O)O)O)C2=C(C=C3C(=CC(=CC3=[O+]2)O)O)OC4C(C(C(C(O4)CO)O)O)O.[Cl-] |