For research use only. Not for therapeutic Use.
Delphinidin-3-O-arabinoside chloride(Cat No.:I041104)is a glycoside of delphinidin, a type of anthocyanin pigment found in various fruits and plants. This compound contains a delphinidin molecule linked to an arabinose sugar, along with a chloride ion. Delphinidin-3-O-arabinoside chloride has shown potential antioxidant and anti-inflammatory properties due to the presence of anthocyanin, which helps neutralize free radicals and reduce oxidative stress. It is being studied for its potential health benefits, including its ability to protect against cardiovascular diseases, improve cognitive function, and reduce the risk of certain cancers, making it an interesting target for future research.
CAS Number | 171370-55-1 |
Synonyms | (2S,3R,4S,5S)-2-[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxane-3,4,5-triol;chloride |
Molecular Formula | C20H19ClO11 |
Purity | ≥95% |
IUPAC Name | (2S,3R,4S,5S)-2-[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxane-3,4,5-triol;chloride |
InChI | InChI=1S/C20H18O11.ClH/c21-8-3-10(22)9-5-15(31-20-18(28)17(27)13(25)6-29-20)19(30-14(9)4-8)7-1-11(23)16(26)12(24)2-7;/h1-5,13,17-18,20,25,27-28H,6H2,(H4-,21,22,23,24,26);1H/t13-,17-,18+,20-;/m0./s1 |
InChIKey | BQQCUFJAUJKCKH-GOWHUIJJSA-N |
SMILES | C1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=CC3=C(C=C(C=C3[O+]=C2C4=CC(=C(C(=C4)O)O)O)O)O)O)O)O.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |