For research use only. Not for therapeutic Use.
Delphinidin chloride (Cat No.: R056293) is a water-soluble anthocyanin, a type of flavonoid pigment found in various fruits, vegetables, and flowers, such as blueberries, grapes, and violets. It is known for its vibrant purple-blue color and has been studied for its antioxidant, anti-inflammatory, and anticancer properties. Delphinidin chloride has shown potential in modulating cellular processes such as apoptosis and cell cycle regulation, making it of interest in cancer research. Additionally, its antioxidant properties may help combat oxidative stress and related diseases.
CAS Number | 528-53-0 |
Synonyms | 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-1-benzopyrylium Chloride; 3,3’,4’,5,5’,7-Hexahydroxyflavylium Chloride; 3,3’,4’,5,5’,7-Hexahydroxy-2-?phenylbenzopyrylium Chloride; 3,3’,4’,5,5’,7-Hexahydroxyflavylium Chloride; Delfinidol Chloride; Delphi |
Molecular Formula | C15H11ClO7 |
Purity | ≥95% |
Target | Epigenetics |
Storage | -20°C |
Related CAS | 13270-61-6 |
IUPAC Name | 2-(3,4,5-trihydroxyphenyl)chromenylium-3,5,7-triol;chloride |
InChI | InChI=1S/C15H10O7.ClH/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6;/h1-5H,(H5-,16,17,18,19,20,21);1H |
InChIKey | FFNDMZIBVDSQFI-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1O)O)O)C2=C(C=C3C(=CC(=CC3=[O+]2)O)O)O.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |