For research use only. Not for therapeutic Use.
Demethoxycurcumin(Cat No.:I002731), also known as Curcumin II, is one of the major active curcuminoids found in turmeric. It exhibits anti-inflammatory properties, making it valuable in the management of inflammatory conditions. Additionally, Demethoxycurcumin has shown cytotoxic effects on human cancer cells by inducing apoptosis, a programmed cell death mechanism. This suggests its potential as a natural compound for cancer treatment. The multifaceted properties of Demethoxycurcumin highlight its therapeutic potential in both inflammatory disorders and cancer.
| CAS Number | 22608-11-3 |
| Synonyms | DMC |
| Molecular Formula | C20H18O5 |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | DMSO: ≥10 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| InChI | InChI=1S/C20H18O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-12,21,24H,13H2,1H3/b9-4+,10-5+ |
| InChIKey | HJTVQHVGMGKONQ-LUZURFALSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC=C(C=C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |