For research use only. Not for therapeutic Use.
Demethyldihydrolanosterol(CAT: R021706) is a sterol derivative involved in the complex biosynthetic pathway leading to the formation of cholesterol and other sterols. It is characterized by the removal of a methyl group and the saturation of the lanosterol molecule, resulting in a structure that plays a critical role in understanding sterol metabolism. This compound is essential for studying the enzymatic steps that regulate cholesterol synthesis and is particularly valuable in research aimed at developing cholesterol-lowering drugs. Its unique structure provides insights into sterol chemistry and the development of therapeutic agents targeting metabolic disorders.
| Catalog Number | R021706 |
| CAS Number | 5241-24-7 |
| Synonyms | (3β,5α)-4,4-Dimethylcholest-8-en-3-ol; 4,4-Dimethyl-5α-cholest-8-en-3β-ol; 4,4-Dimethyl-5α-cholest-8(9)-en-3β-ol; |
| Molecular Formula | C29H50O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3S,5R,10S,13R,14R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C29H50O/c1-19(2)9-8-10-20(3)22-12-13-23-21-11-14-25-27(4,5)26(30)16-18-29(25,7)24(21)15-17-28(22,23)6/h19-20,22-23,25-26,30H,8-18H2,1-7H3/t20-,22-,23+,25+,26+,28-,29-/m1/s1 |
| InChIKey | FYHRVINOXYETMN-QGBOJXOESA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C1(CCC3=C2CCC4C3(CCC(C4(C)C)O)C)C |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Byskov, Anne Grete, et al. "Chemical structure of sterols that activate oocyte meiosis." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>Nature</i> 374.6522 (1995): 559-562.<br /> |
