Demethyleneberberine (DMB), a component of Cortex Phellodendri Chinensis (CPC), significantly alleviates the weight loss and diminishes myeloperoxidase (MPO) activity, while significantly reduces the production of pro-inflammatory cytokines, such as interleukin (IL)-6 and tumor necrosis factor-α (TNF-α), and inhibits the activation of NF-κB signaling pathway. Demethyleneberberine (DMB) potentially ameliorates NAFLD (Non-alcoholic fatty liver disease) by activating AMPK pathways.
| Catalog Number | R072477 |
| CAS Number | 25459-91-0 |
| Molecular Formula | C19H18NO4 |
| Purity | ≥95% |
| Storage | 3 years -20°C powder |
| SMILES | COC1=C(OC)C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(O)C=C4CC3)O |
| Reference | [1] Ying-Ying Chen, et al. Inflamm Res. 2017 Feb;66(2):187-196. |
