For research use only. Not for therapeutic Use.
Demethylzeylasteral (Cat No.:M129218) is the active compound derived from Tripterygium wilfordii Hook F. It exhibits inhibitory effects on UDP-glucuronosyltransferase (UGT) subtypes UGT1A6 and UGT2B7, enzymes involved in drug metabolism and elimination. Moreover, demethylzeylasteral displays immunosuppressive activity, making it potentially valuable in treating immune-related disorders. However, further research is needed to fully understand its mechanisms of action, pharmacokinetics, and potential clinical applications.
| Catalog Number | M129218 |
| CAS Number | 107316-88-1 |
| Molecular Formula | C29H36O6 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | under inert gas (nitrogen or Argon) at 2-8°C |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-9-formyl-10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-8-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid |
| InChI | InChI=1S/C29H36O6/c1-25-6-7-26(2,24(34)35)14-21(25)29(5)11-9-27(3)17-12-19(32)23(33)16(15-30)22(17)18(31)13-20(27)28(29,4)10-8-25/h12-13,15,21,32-33H,6-11,14H2,1-5H3,(H,34,35)/t21-,25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | ZDZSFWLPCFRASW-CPISFEQASA-N |
| SMILES | CC12CCC(CC1C3(CCC4(C5=CC(=C(C(=C5C(=O)C=C4C3(CC2)C)C=O)O)O)C)C)(C)C(=O)O |
