For research use only. Not for therapeutic Use.
Denaverine（Cat No.:M022687） is a pharmacological agent classified as a spasmolytic, which is used primarily in veterinary medicine to relieve smooth muscle spasms. It acts by inhibiting phosphodiesterase enzymes, leading to an increase in cyclic AMP within muscle cells, which in turn reduces muscle contractions. Denaverine is particularly effective in treating gastrointestinal and urinary disorders in animals such as horses and cattle, helping to manage colic and spasmodic conditions. Its efficacy in alleviating pain and discomfort during spasms makes it a valuable tool in the care and treatment of domesticated animals.
| Catalog Number | M022687 |
| CAS Number | 3321-06-0 |
| Synonyms | Denaverine;Denaverinhydrochlorid;1-METHYL-3-(TETRAHYDRO-2H-PYRAN-4-YL)UREA;Denaverin HCl |
| Molecular Formula | C24H34ClNO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(dimethylamino)ethyl 2-(2-ethylbutoxy)-2,2-diphenylacetate;hydrochloride |
| InChI | InChI=1S/C24H33NO3.ClH/c1-5-20(6-2)19-28-24(21-13-9-7-10-14-21,22-15-11-8-12-16-22)23(26)27-18-17-25(3)4;/h7-16,20H,5-6,17-19H2,1-4H3;1H |
| InChIKey | RSDBEODKTNUEMS-UHFFFAOYSA-N |
| SMILES | CCC(CC)COC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCCN(C)C.Cl |
