For research use only. Not for therapeutic Use.
Dendrobine(Cat No.:R063747)is a naturally occurring alkaloid isolated from the Dendrobium species of orchids. Known for its pharmacological properties, Dendrobine exhibits significant bioactivity, particularly in the modulation of ion channels and receptors. It has shown promise in cancer research, demonstrating potential anticancer and anti-inflammatory effects. Additionally, Dendrobine has been studied for its neuroprotective properties and its ability to regulate cell signaling pathways. Due to its diverse biological activity, it holds potential for further development as a therapeutic agent in various medical applications, including cancer and neurological diseases.
CAS Number | 2115-91-5 |
Synonyms | Dendroban-12-one; (-)-Dendrobine; 12-Oxodendrobane; [2aS-(2aα,4aα,5β,6α,7β,7aα,7bα)]-Decahydro-1,7b-dimethyl-6-(1-methylethyl)-7,5-(epoxymethano)-1H-cyclopent[cd]indol-9-one; NSC 607862 |
Molecular Formula | C₁₆H₂₅NO₂ |
Purity | ≥95% |
Target | Influenza Virus |
Storage | 4°C, protect from light |
IUPAC Name | (1S,4S,7S,8R,11R,12R,13S)-2,12-dimethyl-13-propan-2-yl-10-oxa-2-azatetracyclo[5.4.1.18,11.04,12]tridecan-9-one |
InChI | InChI=1S/C16H25NO2/c1-8(2)11-12-10-6-5-9-7-17(4)14(16(9,10)3)13(11)19-15(12)18/h8-14H,5-7H2,1-4H3/t9-,10+,11+,12-,13-,14-,16+/m1/s1 |
InChIKey | RYAHJFGVOCZDEI-UFFNCVEVSA-N |
SMILES | CC(C)[C@H]1[C@H]2[C@@H]3CC[C@H]4[C@@]3([C@@H]([C@@H]1OC2=O)N(C4)C)C |