For research use only. Not for therapeutic Use.
Dendrophenol(Cat No.:M013061), a synthetic molecule, is part of a class of advanced dendritic polymers known for their highly branched, tree-like structures. This compound typically incorporates phenol functional groups into its dendritic architecture, which enhances its ability to interact with various chemical entities and substrates. Dendrophenol is particularly noted for its applications in catalysis and materials science, where its multiple reactive sites can be exploited for efficient and selective reactions. Its structure allows for a high degree of functionality and versatility, making it useful in creating new materials with specific chemical and physical properties.
CAS Number | 108853-14-1 |
Molecular Formula | C17H20O5 |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | 4-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxyphenol |
InChI | InChI=1S/C17H20O5/c1-20-14-8-11(6-7-13(14)18)4-5-12-9-15(21-2)17(19)16(10-12)22-3/h6-10,18-19H,4-5H2,1-3H3 |
InChIKey | YTRAYUIKLRABOQ-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1O)OC)CCC2=CC(=C(C=C2)O)OC |