For research use only. Not for therapeutic Use.
(-)-Denudatin B is an antiplatelet agent. (-)-Denudatin B relaxed vascular smooth muscle by inhibiting the Ca2+ influx through voltage-gated and receptor-operated Ca2+ channels[1]. And (-)-Denudatin B has nonspecific antiplatelet action
| Catalog Number | R015671 |
| CAS Number | 87402-88-8 |
| Synonyms | (2S,3R,3aR)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
| Molecular Formula | C21H24O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+,21-/m1/s1 |
| InChIKey | VDYACOATPFOZIO-HBUDHLSFSA-N |
| SMILES | CC1C(OC2=CC(=O)C(=CC12OC)CC=C)C3=CC(=C(C=C3)OC)OC |
| Reference | [1]. Yu SM,et al. Vasorelaxing effect in rat thoracic aorta caused by denudatin B, isolated from the Chinese herb, magnolia fargesii. Eur J Pharmacol. 1990;187(1):39-47. [2]. Teng CM, et al. Inhibition of thrombin- and collagen-induced phosphoinositides breakdown in rabbit platelets by a PAF antagonist–denudatin B, an isomer of kadsurenone. Thromb Res. 1990;59(1):121-130. |
