For research use only. Not for therapeutic Use.
Deoxybenzoin Oxime-15N is a high-purity, isotopically labeled compound vital for advanced pharmaceutical and biochemical research. This version of deoxybenzoin oxime, enriched with 15N, is crucial for studying metabolic pathways, drug interactions, and molecular mechanisms. Its stable isotope labeling ensures precise and reliable analytical results. Ideal for applications in medicinal chemistry, pharmacokinetics, and analytical chemistry, Deoxybenzoin Oxime-15N integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R010038 |
| CAS Number | 1185237-85-7 |
| Synonyms | (1E)-1,2-Diphenylethanone Oxime-15N; (E)-2-Phenylacetophenone Oxime-15N |
| Molecular Formula | C14H13NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (NE)-N-(1,2-diphenylethylidene)hydroxylamine |
| InChI | InChI=1S/C14H13NO/c16-15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,16H,11H2/b15-14+/i15+1 |
| InChIKey | PWCUVRROUAKTLL-VMUHYYQNSA-N |
| SMILES | C1=CC=C(C=C1)CC(=NO)C2=CC=CC=C2 |
