For research use only. Not for therapeutic Use.
Deoxycholic acid sodium salt(Cat No.:I013024)is the sodium salt form of deoxycholic acid, a bile acid that occurs naturally in the body as a product of the breakdown of cholesterol. It is involved in the emulsification and absorption of dietary fats in the intestines. In its sodium salt form, deoxycholic acid is used in various pharmaceutical and cosmetic applications, particularly in fat dissolution treatments, such as injectable lipolysis for body contouring. It is also studied for its potential use in treating conditions like gallstones and for its role in modulating fat metabolism.
CAS Number | 302-95-4 |
Molecular Formula | C₂₄H₃₉NaO₄ |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | sodium;(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
InChI | InChI=1S/C24H40O4.Na/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3;/h14-21,25-26H,4-13H2,1-3H3,(H,27,28);/q;+1/p-1/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-;/m1./s1 |
InChIKey | FHHPUSMSKHSNKW-SMOYURAASA-M |
SMILES | C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C.[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |