For research use only. Not for therapeutic Use.
Deoxymannojirimycin hydrochloride(CAT: R020684) is a synthetic compound and an inhibitor of certain enzymes called alpha-glucosidases. Its mode of action involves being a pharmacological chaperone and a potential therapeutic agent for certain lysosomal storage disorders, particularly Gaucher disease. Deoxymannojirimycin hydrochloride works by binding to the active site of alpha-glucosidase enzymes, helping in the proper folding and trafficking of misfolded enzymes, and enhancing their activity.
| Catalog Number | R020684 |
| CAS Number | 73465-43-7 |
| Synonyms | (2R,3R,4R,5R)-2-(Hydroxymethyl)-3,4,5-piperidinetriol Hydrochloride; Manno-1-deoxynojirimycin Hydrochloride; |
| Molecular Formula | C6H14ClNO4 |
| Purity | ≥95% |
| Target | Glycosylases |
| Solubility | Soluble to 50 mM in sterile water |
| Storage | Desiccate at +4C |
| IUPAC Name | (2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChI | InChI=1S/C6H13NO4.ClH/c8-2-3-5(10)6(11)4(9)1-7-3;/h3-11H,1-2H2;1H/t3-,4-,5-,6-;/m1./s1 |
| InChIKey | ZJIHMALTJRDNQI-MVNLRXSJSA-N |
| SMILES | C1C(C(C(C(N1)CO)O)O)O.Cl |
