1-Deoxynojirimycin (1-dNM) (hydrochloride), produced by <em>Bacillus</em> species, is a glucose analog that potently inhibits α-glucosidase I and II. It prevents the formation of complex N-linked oligosaccharides in yeast and intact mammalian cells by inhibiting both α-glucosidase I and II with IC<sub>50</sub> values of ~2 µM. The FDA has granted orphan drug designation to dNM (hydrochloride) for the treatment of Pompe disease, an inherited lysosomal storage disorder caused by a mutation that alters the structure and stability of α-glucosidase. 1-dNM, at a concentration of 0.4 mM, also inhibits virus spread in HIV-infected lymphocyte cultures by interfering with α-glucosidase activity.
| Catalog Number | R000996 |
| CAS Number | 73285-50-4 |
| Synonyms | (2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol Hydrochloride; 1-Deoxynojirimycin Hydrochloride; AT 2220; Duvoglustat Hydrochloride; Moranoline Hydrochloride; DNJ Hydrochloride |
| Molecular Formula | C6H14ClNO4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChI | InChI=1S/C6H13NO4.ClH/c8-2-3-5(10)6(11)4(9)1-7-3;/h3-11H,1-2H2;1H/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | ZJIHMALTJRDNQI-VFQQELCFSA-N |
| SMILES | C1C(C(C(C(N1)CO)O)O)O.Cl |
