For research use only. Not for therapeutic Use.
Deoxynyboquinone (CAT: I006436) is a synthetic quinone derivative that has shown potent anticancer activity through its ability to generate reactive oxygen species (ROS) and inhibit mitochondrial complex I. By disrupting mitochondrial function, Deoxynyboquinone induces oxidative stress in cancer cells, leading to apoptosis and cell death, particularly in tumors with defective antioxidant defenses. This compound is of significant interest in oncology research for its potential to target drug-resistant cancers and tumors with high metabolic activity. Its unique mechanism of action makes it a valuable tool for exploring novel cancer treatments focused on mitochondrial disruption and ROS generation.
| Catalog Number | I006436 |
| CAS Number | 96748-86-6 |
| Synonyms | 1,4,6-trimethyl-9H-pyrido[3,2-g]quinoline-2,5,8,10-tetrone |
| Molecular Formula | C15H12N2O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H12N2O4/c1-6-4-8(18)16-12-10(6)14(20)11-7(2)5-9(19)17(3)13(11)15(12)21/h4-5H,1-3H3,(H,16,18) |
| InChIKey | KJYPAIRTXRKKHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C(=O)C3=C(C2=O)N(C(=O)C=C3C)C |
