For research use only. Not for therapeutic Use.
Deoxyshikonin（Cat No.:R072480）is a naturally occurring naphthoquinone compound found in Lithospermum erythrorhizon and other species of the Boraginaceae family. It exhibits a range of bioactive properties, including antioxidant, anti-inflammatory, and anticancer effects. Deoxyshikonin has been studied for its potential therapeutic applications in skin regeneration, wound healing, and as an antimicrobial agent. Its mechanism of action involves the modulation of key signaling pathways, making it a promising candidate for drug development, particularly in the treatment of skin diseases and certain cancers. Deoxyshikonin’s versatility in biomedical research continues to be explored.
| Catalog Number | R072480 |
| CAS Number | 43043-74-9 |
| Molecular Formula | C16H16O4 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | Store at 4°C |
| IUPAC Name | 5,8-dihydroxy-2-(4-methylpent-3-enyl)naphthalene-1,4-dione |
| InChI | InChI=1S/C16H16O4/c1-9(2)4-3-5-10-8-13(19)14-11(17)6-7-12(18)15(14)16(10)20/h4,6-8,17-18H,3,5H2,1-2H3 |
| InChIKey | VOMDIEGPEURZJO-UHFFFAOYSA-N |
| SMILES | CC(=CCCC1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)C |
