For research use only. Not for therapeutic Use.
Deracoxib（Cat No.:I002210） is a non-narcotic and non-steroidal anti-inflammatory drug (NSAID) that acts as a selective inhibitor of cyclooxygenase-2 (COX-2). It is commonly used in veterinary medicine for the management of pain and inflammation associated with conditions such as osteoarthritis and postoperative pain in dogs. By inhibiting COX-2, deracoxib helps reduce the production of inflammatory substances called prostaglandins, leading to pain relief and decreased inflammation.
| Catalog Number | I002210 |
| CAS Number | 169590-41-4 |
| Synonyms | 4-[3-(difluoromethyl)-5-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]benzenesulfonamide |
| Molecular Formula | C₁₇H₁₄ClF₃N₃O₃S |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | 10 mM in DMSO |
| Storage | 2-8°C |
| IC50 | 70 to 150 uM(inhibition of 3 osteosarcoma cell lines) |
| IUPAC Name | 4-[3-(difluoromethyl)-5-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]benzenesulfonamide |
| InChI | InChI=1S/C17H14F3N3O3S/c1-26-16-7-2-10(8-13(16)18)15-9-14(17(19)20)22-23(15)11-3-5-12(6-4-11)27(21,24)25/h2-9,17H,1H3,(H2,21,24,25) |
| InChIKey | WAZQAZKAZLXFMK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)F)F |
