For research use only. Not for therapeutic Use.
Deruxtecan analog 2 monoTFA (Cat No.: I040086) is a modified derivative of deruxtecan, an antibody-drug conjugate (ADC) used in cancer therapy. It contains a potent cytotoxic agent linked to an antibody targeting specific tumor-associated antigens. The “monoTFA” refers to the trifluoroacetate salt form, which helps improve the solubility and stability of the compound. Deruxtecan analog 2 monoTFA is being explored for its potential to target cancer cells more precisely, enhancing therapeutic efficacy while minimizing off-target effects, particularly in treating solid tumors.
CAS Number | 2758874-59-6 |
Synonyms | 2-amino-N-[[2-[[(10S,23S)-10-ethyl-18-fluoro-10-hydroxy-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]amino]-2-oxoethoxy]methyl]acetamide;2,2,2-trifluoroacetic acid |
Molecular Formula | C31H31F4N5O9 |
Purity | ≥95% |
InChI | InChI=1S/C29H30FN5O7.C2HF3O2/c1-3-29(40)17-6-21-26-15(9-35(21)27(38)16(17)10-42-28(29)39)25-19(33-23(37)11-41-12-32-22(36)8-31)5-4-14-13(2)18(30)7-20(34-26)24(14)25;3-2(4,5)1(6)7/h6-7,19,40H,3-5,8-12,31H2,1-2H3,(H,32,36)(H,33,37);(H,6,7)/t19-,29-;/m0./s1 |
InChIKey | DXZHUKXYWJZGIG-XUEJMOKYSA-N |
SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=C5C(CCC6=C5C(=CC(=C6C)F)N=C4C3=C2)NC(=O)COCNC(=O)CN)O.C(=O)(C(F)(F)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |