Desacetyl Triflusal-13C6 is an isotopically labeled compound essential for advanced pharmaceutical and biochemical research. Featuring six carbon-13 isotopes, it provides enhanced stability and precision in mass spectrometry and NMR spectroscopy. This labeled analog is crucial for studying the pharmacokinetics, metabolism, and mechanism of action of triflusal and its derivatives. It ensures accurate quantification and reliable analytical results, making it an ideal standard for high-precision research in drug development, anti-inflammatory therapy, and the investigation of metabolic pathways of antiplatelet agents.
Catalog Number | R013088 |
CAS Number | 1246817-12-8 |
Synonyms | 2-Hydroxy-4-(trifluoromethyl)benzoic Acid-13C6; α,α,α-Trifluoro-2,4-cresotic Acid-13C6; 4-(Trifluoromethyl)salicylic Acid-13C6; 4-Trifluoromethyl-2-hydroxybenzoic Acid-13C6; ? |
Molecular Formula | C8H5F3O3 |
Purity | 95% |
Storage | Store at RT |
IUPAC Name | 2-hydroxy-4-(trifluoromethyl)benzoic acid |
InChI | InChI=1S/C8H5F3O3/c9-8(10,11)4-1-2-5(7(13)14)6(12)3-4/h1-3,12H,(H,13,14) |
InChIKey | XMLFPUBZFSJWCN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(F)(F)F)O)C(=O)O |