For research use only. Not for therapeutic Use.
Desbutyl Bumetanide-d5 is a deuterated form of desbutyl bumetanide, featuring five deuterium atoms. This high-purity compound is crucial for advanced pharmaceutical and biochemical research, particularly in studying the pharmacokinetics, metabolic pathways, and drug interactions of bumetanide and its analogs. Its stable isotope labeling ensures precise and reliable analytical results. Desbutyl Bumetanide-d5 is ideal for research on diuretic mechanisms and renal function, offering a robust and consistent tool for high-precision scientific investigations, seamlessly integrating into existing research protocols.
| Catalog Number | R012171 |
| CAS Number | 1072125-54-2 |
| Synonyms | 3-Amino-5-(aminosulfonyl)-4-phenoxy-benzoic Acid-d5; 3-Amino-4-phenoxy-5-sulfamoylbenzoic Acid-d5; Desbutylbumetanide-d5; PF 1578-d5; |
| Molecular Formula | C13H12N2O5S |
| Purity | ≥95% |
| Storage | 3 years -20 ℃ |
| IUPAC Name | 3-amino-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid |
| InChI | InChI=1S/C13H12N2O5S/c14-10-6-8(13(16)17)7-11(21(15,18)19)12(10)20-9-4-2-1-3-5-9/h1-7H,14H2,(H,16,17)(H2,15,18,19)/i1D,2D,3D,4D,5D |
| InChIKey | GVQZPZSQRCXSJI-RALIUCGRSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2S(=O)(=O)N)C(=O)O)N |
