Desethylatrazine-d7（Cat No.:S001140） is a deuterated analog of Desethylatrazine, featuring seven deuterium atoms, which replace most of the hydrogen atoms. This isotopic enrichment significantly increases its chemical stability, making it ideal for environmental monitoring and pesticide residue analysis. It serves as a key tracer in studying the degradation pathways and persistence of atrazine, a widely used herbicide, in ecosystems. Utilized in advanced analytical methodologies like mass spectrometry, Desethylatrazine-d7 provides accurate and sensitive detection, crucial for assessing environmental contamination and understanding the ecological impact of atrazine derivatives.
| Catalog Number | S001140 |
| CAS Number | 1216649-31-8 |
| Molecular Formula | C6H3D7ClN5 |
| Purity | ≥95% |
| IUPAC Name | 6-chloro-2-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine |
| InChI | InChI=1S/C6H10ClN5/c1-3(2)9-6-11-4(7)10-5(8)12-6/h3H,1-2H3,(H3,8,9,10,11,12)/i1D3,2D3,3D |
| InChIKey | DFWFIQKMSFGDCQ-YYWVXINBSA-N |
| SMILES | CC(C)NC1=NC(=NC(=N1)N)Cl |
