For research use only. Not for therapeutic Use.
Desglymidodrine（Cat No.:R001800）is a synthetic peptide derivative that acts as an adrenergic agonist, primarily used to regulate blood pressure. It is a metabolite of midodrine, which is often prescribed to treat orthostatic hypotension. Desglymidodrine works by stimulating alpha-1 adrenergic receptors, leading to vasoconstriction and an increase in blood pressure. Researchers are exploring its potential applications in managing hypotension in various clinical settings. Its pharmacokinetics and effectiveness as a vasopressor are being evaluated in clinical trials to determine its safety and potential advantages over related therapies.
| CAS Number | 3600-87-1 |
| Synonyms | 2-amino-1-(2,5-dimethoxyphenyl)ethanol |
| Molecular Formula | C10H15NO3 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-1-(2,5-dimethoxyphenyl)ethanol |
| InChI | InChI=1S/C10H15NO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5,9,12H,6,11H2,1-2H3 |
| InChIKey | VFRCNXKYZVQYLX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(CN)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
