For research use only. Not for therapeutic Use.
Desidustat（Cat No.:I011892）, is a promising pharmaceutical compound under investigation for its potential in the treatment of anemia associated with chronic kidney disease (CKD). It belongs to a class of drugs known as hypoxia-inducible factor prolyl hydroxylase inhibitors (HIF-PHIs). Desidustat works by stabilizing hypoxia-inducible factors, which can stimulate the production of red blood cells and improve hemoglobin levels, addressing anemia in CKD patients.
| Catalog Number | I011892 |
| CAS Number | 1616690-16-4 |
| Synonyms | Desidustat;N-[1-(cyclopropylmethoxy)-4-hydroxy-2-oxo- 1,2-dihydroquinoline-3-carbonyl]glycine |
| Molecular Formula | C16H16N2O6 |
| Purity | ≥95% |
| Target | HIF/HIF Prolyl-Hydroxylase |
| Solubility | Soluble in DMSO |
| Storage | Store at 0-8 °C |
| IUPAC Name | 2-[[1-(cyclopropylmethoxy)-4-hydroxy-2-oxoquinoline-3-carbonyl]amino]acetic acid |
| InChI | InChI=1S/C16H16N2O6/c19-12(20)7-17-15(22)13-14(21)10-3-1-2-4-11(10)18(16(13)23)24-8-9-5-6-9/h1-4,9,21H,5-8H2,(H,17,22)(H,19,20) |
| InChIKey | IKRKQQLJYBAPQT-UHFFFAOYSA-N |
| SMILES | C1CC1CON2C3=CC=CC=C3C(=C(C2=O)C(=O)NCC(=O)O)O |
