For research use only. Not for therapeutic Use.
Desipramine-d3(Cat No.:R008182) is a high-purity, deuterium-labeled compound essential for advanced pharmaceutical and biochemical research. Featuring three deuterium atoms, this isotopically labeled version of Desipramine is crucial for studies on antidepressant drug metabolism, pharmacokinetics, and receptor binding assays. Desipramine-d3 aids in the development of therapeutic agents for depression and enhances the understanding of drug action mechanisms, making it a valuable tool for scientific investigations and drug development.
CAS Number | 65100-49-4 |
Synonyms | 10,11-Dihydro-N-(methyl-d3)-5H-dibenz[b,f]azepine-5-propanamine; G-35020-d3; JB-8181-d3; NSC-114901-d3; Norpramin-d3; Nortimil-d3; Pertofran-d3; Pertofrane-d3; Petylyl-d3; |
Molecular Formula | C18H22N2 |
Purity | ≥95% |
Target | Dopamine Transporter |
Storage | Store at +4C |
IUPAC Name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine |
InChI | InChI=1S/C18H22N2/c1-19-13-6-14-20-17-9-4-2-7-15(17)11-12-16-8-3-5-10-18(16)20/h2-5,7-10,19H,6,11-14H2,1H3/i1D3 |
InChIKey | HCYAFALTSJYZDH-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])NCCCN1C2=CC=CC=C2CCC3=CC=CC=C31 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |