For research use only. Not for therapeutic Use.
Desmethyl Celecoxib is a key metabolite of the nonsteroidal anti-inflammatory drug (NSAID) Celecoxib, known for its selective inhibition of cyclooxygenase-2 (COX-2). Lacking a methyl group compared to its parent compound, Desmethyl Celecoxib is important in studying the metabolism and pharmacokinetics of Celecoxib. This metabolite is valuable in drug metabolism research, as it helps understand Celecoxib’s bioavailability, efficacy, and safety profile, particularly its role in inflammation and potential anti-cancer properties in pharmaceutical development.
Catalog Number | R063163 |
CAS Number | 170569-87-6 |
Synonyms | 4-(5-Phenyl-3-trifluoromethyl-1H-pyrazol-1-yl)benzenesulfonamide |
Molecular Formula | C16H12F3N3O2S |
Purity | ≥95% |
Target | COX |
Storage | -20°C |
IUPAC Name | 4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
InChI | InChI=1S/C16H12F3N3O2S/c17-16(18,19)15-10-14(11-4-2-1-3-5-11)22(21-15)12-6-8-13(9-7-12)25(20,23)24/h1-10H,(H2,20,23,24) |
InChIKey | MQPLMBSDWYIIID-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |