For research use only. Not for therapeutic Use.
Desmethylanethol trithione (DMTT) is a sulfur-containing compound derived from anethol trithione, widely studied for its hepatoprotective and choleretic properties. DMTT enhances bile secretion, promoting liver detoxification and protecting against oxidative stress. It has been explored for its potential in treating liver disorders and preventing drug-induced liver injury. Additionally, DMTT exhibits antioxidant and anti-inflammatory activities, making it a valuable tool in research on liver health and metabolic diseases. Its versatility underscores its significance in advancing hepatology and pharmacological studies.
CAS Number | 18274-81-2 |
Synonyms | ACS1 |
Molecular Formula | C9H6OS3 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 4-(5-sulfanyldithiol-3-ylidene)cyclohexa-2,5-dien-1-one |
InChI | InChI=1S/C9H6OS3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5,11H |
InChIKey | ROGBQLVTFIEBAV-UHFFFAOYSA-N |
SMILES | C1=CC(=O)C=CC1=C2C=C(SS2)S |