For research use only. Not for therapeutic Use.
Desmosterol is a cholesterol precursor in the biosynthesis pathway, specifically the immediate precursor to cholesterol itself. It plays a vital role in the production of sterols and is involved in various cellular processes, including membrane structure, lipid metabolism, and the regulation of cell signaling. Elevated levels of Desmosterol can indicate disruptions in cholesterol metabolism, and it is associated with certain conditions, such as desmosterolosis, a rare genetic disorder. Additionally, Desmosterol has gained interest in studies related to neurodegenerative diseases, such as Alzheimer’s, where altered cholesterol homeostasis is observed. Its role in lipid biology makes it crucial in both health and disease research.
CAS Number | 313-04-2 |
Synonyms | (3β)-Cholesta-5,24-dien-3-ol; Cholesta-5,24-dien-3β-ol; 24,25-Dehydrocholesterol; 24-Dehydrocholesterol; NSC 226126; |
Molecular Formula | C27H44O |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
InChI | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,9,19,21-25,28H,6,8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
InChIKey | AVSXSVCZWQODGV-DPAQBDIFSA-N |
SMILES | CC(CCC=C(C)C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |