For research use only. Not for therapeutic Use.
Desoxypipradrol is a stimulant compound that acts on the central nervous system, known for its prolonged effects. Initially developed in the 1950s for treating conditions like narcolepsy and ADHD, it increases concentrations of dopamine and norepinephrine. Due to its potent stimulant properties, desoxypipradrol is researched for its potential therapeutic uses but also carries a risk of abuse and dependence.
| Catalog Number | R053964 |
| CAS Number | 519-74-4 |
| Synonyms | 2-(Diphenylmethyl)piperidine; (±)-Desoxypipradrol; 2-Diphenylmethylpiperidine; Ciba 14469; Deoxypipradrol; Desoxypipradrol; |
| Molecular Formula | C18H21N |
| Purity | ≥95% |
| Storage | -20 ℃ |
| IUPAC Name | 2-benzhydrylpiperidine |
| InChI | InChI=1S/C18H21N/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17/h1-6,9-12,17-19H,7-8,13-14H2 |
| InChIKey | RWTNXJXZVGHMGI-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
