For research use only. Not for therapeutic Use.
Desthiobiotin-PEG4-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Desthiobiotin-PEG4-propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Catalog Number | I044716 |
| CAS Number | 1951424-89-7 |
| Synonyms | 6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide |
| Molecular Formula | C21H37N3O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H37N3O6/c1-3-10-27-12-14-29-16-17-30-15-13-28-11-9-22-20(25)8-6-4-5-7-19-18(2)23-21(26)24-19/h1,18-19H,4-17H2,2H3,(H,22,25)(H2,23,24,26)/t18-,19+/m0/s1 |
| InChIKey | CQSNBVBVAYQBHF-RBUKOAKNSA-N |
| SMILES | CC1C(NC(=O)N1)CCCCCC(=O)NCCOCCOCCOCCOCC#C |
| Reference | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
