For research use only. Not for therapeutic Use.
Destruxin B (Cat No.: R000174) is a cyclic peptide toxin produced by certain species of Metarhizium fungi, known for its potent insecticidal properties. It functions by disrupting cellular processes, particularly by inhibiting the immune response in insects. Destruxin B has attracted interest in agricultural and biocontrol applications for its ability to target pests without harming humans or animals. Additionally, studies suggest it may have anticancer potential due to its ability to affect cell growth and induce apoptosis in cancer cells.
CAS Number | 2503-26-6 |
Molecular Formula | C30H51N5O7 |
Purity | ≥95% |
Target | Bcl-2 Family |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | (3R,10S,13S,16S,19S)-16-[(2S)-butan-2-yl]-10,11,14-trimethyl-3-(2-methylpropyl)-13-propan-2-yl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
InChI | 1S/C30H51N5O7/c1-10-19(6)24-29(40)34(9)25(18(4)5)30(41)33(8)20(7)26(37)31-14-13-23(36)42-22(16-17(2)3)28(39)35-15-11-12-21(35)27(38)32-24/h17-22,24-25H,10-16H2,1-9H3,(H,31,37)(H,32,38)/t19-,20-,21-,22+,24-,25-/m0/s1 |
InChIKey | GNBHVMBELHWUIF-VTSYCQLTSA-N |
SMILES | O=C(N[C@]([C@@H](C)CC)([H])C(N(C)[C@@H](C(C)C)C(N(C)[C@H]1C)=O)=O)[C@@]2([H])N(CCC2)C([C@@H](CC(C)C)OC(CCNC1=O)=O)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |