For research use only. Not for therapeutic Use.
Deupirfenidone-d3(Cat No.:S000535) is a deuterated variant of pirfenidone, where three hydrogen atoms are replaced with deuterium. Pirfenidone is an anti-fibrotic and anti-inflammatory medication used primarily to treat idiopathic pulmonary fibrosis (IPF), a condition characterized by lung tissue scarring. The incorporation of deuterium in deupirfenidone-d3 enhances its metabolic stability, potentially leading to altered pharmacokinetics and reduced side effects. This deuterated form is valuable in research for better understanding the drug’s metabolic pathways and for investigating its mechanism of action, which could facilitate the development of more effective treatments for fibrotic diseases.
CAS Number | 1093951-85-9 |
Molecular Formula | C12H8D3NO |
Purity | ≥95% |
IUPAC Name | 1-phenyl-5-(trideuteriomethyl)pyridin-2-one |
InChI | InChI=1S/C12H11NO/c1-10-7-8-12(14)13(9-10)11-5-3-2-4-6-11/h2-9H,1H3/i1D3 |
InChIKey | ISWRGOKTTBVCFA-FIBGUPNXSA-N |
SMILES | CC1=CN(C(=O)C=C1)C2=CC=CC=C2 |