For research use only. Not for therapeutic Use.
Dexetimide(CAT: I006444) is a potent anticholinergic agent primarily used in the treatment of Parkinson’s disease and other movement disorders. It works by blocking muscarinic acetylcholine receptors in the brain, which helps reduce the overactivity of cholinergic neurons that contribute to the motor symptoms of Parkinson’s, such as tremors and rigidity. Dexetimide is also investigated for its potential to treat drug-induced extrapyramidal symptoms, such as those caused by antipsychotic medications. Its ability to modulate neurotransmitter activity makes it a valuable compound in neurological research, particularly in studies focused on motor function disorders and anticholinergic therapy.
| Catalog Number | I006444 |
| CAS Number | 21888-98-2 |
| Synonyms | (3S)-3-(1-benzylpiperidin-4-yl)-3-phenylpiperidine-2,6-dione |
| Molecular Formula | C23H26N2O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C23H26N2O2/c26-21-11-14-23(22(27)24-21,19-9-5-2-6-10-19)20-12-15-25(16-13-20)17-18-7-3-1-4-8-18/h1-10,20H,11-17H2,(H,24,26,27)/t23-/m1/s1 |
| InChIKey | LQQIVYSCPWCSSD-HSZRJFAPSA-N |
| SMILES | C1CN(CCC1C2(CCC(=O)NC2=O)C3=CC=CC=C3)CC4=CC=CC=C4 |
