For research use only. Not for therapeutic Use.
Dexmedetomidine（Cat No.:A000563）is a selective alpha-2 adrenergic agonist used for sedation in intensive care settings and during surgical procedures. It provides sedation, analgesia, and anxiolysis without causing significant respiratory depression. Dexmedetomidine works by activating alpha-2 receptors in the central nervous system, leading to reduced sympathetic activity and enhanced parasympathetic activity. This results in a calm, sedated state with potential for easy arousal and cooperation. It is particularly useful for patients requiring prolonged sedation and has a favorable safety profile, with common side effects including bradycardia and hypotension.
| Catalog Number | A000563 |
| CAS Number | 113775-47-6 |
| Synonyms | 113775-47-6; Dexmedetomidina; Dexmedetomidinum; MPV 1440; CHEMBL778 |
| Molecular Formula | C13H16N2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | >10mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 5-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole |
| InChI | InChI=1S/C13H16N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | CUHVIMMYOGQXCV-NSHDSACASA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN=CN2)C |
