For research use only. Not for therapeutic Use.
Dextrorphan is a phencyclidine-<wbr></wbr>like metabolite of dextromethorphan (Item No. <span class=/itemid/>13950</span>), an antitussive found in cough medicines. Dextrorphan, while also having antitussive activity, is psychoactive, leading to the abuse of cough medicines containing the parent compound. Dextrorphan antagonizes NMDA and µ-<wbr></wbr>opioid receptors (K<sub>i</sub>s = 54 and 420 nM, respectively) and inhibits norepinephrine and serotonin transporters (K<sub>i</sub>s = 340 and 401 nM, respectively). This product is intended for forensic and research applications.
| Catalog Number | R005912 |
| CAS Number | 143-98-6 |
| Synonyms | (9α,13α,14α)-17-Methyl-morphinan-3-ol (2R,3R)-2,3-Dihydroxybutanedioate; NIH 4591; d-3-Hydroxy-N-methylmorphinan Tartrate; |
| Molecular Formula | C21H29NO7 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C17H23NO.C4H6O6/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17;5-1(3(7)8)2(6)4(9)10/h5-6,11,14,16,19H,2-4,7-10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t14-,16+,17+;1-,2-/m11/s1 |
| InChIKey | RWTWIZDKEIWLKQ-XCPWPWHNSA-N |
| SMILES | CN1CCC23CCCCC2C1CC4=C3C=C(C=C4)O.C(C(C(=O)O)O)(C(=O)O)O |
