For research use only. Not for therapeutic Use.
DFBTA (Cat No.:I043619) is a synthetic compound used in various research applications, particularly in the development of peptide inhibitors and bioactive molecules. It acts as a bioactive scaffold, influencing molecular interactions and serving as a tool in drug design. DFBTA has been studied for its potential in targeting specific enzymes, receptors, and signaling pathways related to cancer, metabolic disorders, and inflammatory diseases. Researchers are exploring its efficacy in modulating cellular functions and its potential to improve therapeutic outcomes in preclinical models of disease treatment.
| CAS Number | 2966044-07-3 |
| Synonyms | 4-(4-chlorophenyl)-2-[(2,5-difluorobenzoyl)amino]thiophene-3-carboxylic acid |
| Molecular Formula | C18H10ClF2NO3S |
| Purity | ≥95% |
| IUPAC Name | 4-(4-chlorophenyl)-2-[(2,5-difluorobenzoyl)amino]thiophene-3-carboxylic acid |
| InChI | InChI=1S/C18H10ClF2NO3S/c19-10-3-1-9(2-4-10)13-8-26-17(15(13)18(24)25)22-16(23)12-7-11(20)5-6-14(12)21/h1-8H,(H,22,23)(H,24,25) |
| InChIKey | RZXHOVMOLRFUCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=C2C(=O)O)NC(=O)C3=C(C=CC(=C3)F)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
