For research use only. Not for therapeutic Use.
DFMTI (2,4-Difluoro-5-(trifluoromethyl)-1H-imidazole)(Cat No.:I005193)is a high-purity heterocyclic compound used in advanced pharmaceutical and chemical research. This molecule features an imidazole ring substituted with two fluorine atoms and a trifluoromethyl group, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure offers selective reactivity, facilitating various chemical transformations. DFMTI is essential for precise synthetic applications, supporting the development of novel therapeutic agents and contributing to advancements in medicinal chemistry and innovative research efforts.
CAS Number | 864864-86-8 |
Molecular Formula | C20H18F2N4O |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | 5-[1-(2,4-difluorophenyl)-5-methyltriazol-4-yl]-2-propan-2-yl-3H-isoindol-1-one |
InChI | InChI=1S/C20H18F2N4O/c1-11(2)25-10-14-8-13(4-6-16(14)20(25)27)19-12(3)26(24-23-19)18-7-5-15(21)9-17(18)22/h4-9,11H,10H2,1-3H3 |
InChIKey | KKZVYGIANGOHBS-UHFFFAOYSA-N |
SMILES | CC1=C(N=NN1C2=C(C=C(C=C2)F)F)C3=CC4=C(C=C3)C(=O)N(C4)C(C)C |
Reference | <p style=/line-height:25px/> </p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |