For research use only. Not for therapeutic Use.
DG70 (CAT: I028323 is a biphenyl amide compound that acts as a respiration inhibitor targeting Mycobacterium tuberculosis. It specifically inhibits the enzyme demethylmenaquinone methyltransferase (MenG), with an IC₅₀ value of 2.6 ± 0.6 μM, blocking the catalytic methylation step essential for menaquinone biosynthesis. By disrupting the electron transport chain, DG70 impairs bacterial energy metabolism, leading to growth inhibition. Its targeted mechanism and potent activity make DG70 a valuable tool for tuberculosis (TB) research, particularly in studying novel pathways for antimicrobial intervention and the development of next-generation therapeutics against drug-resistant M. tuberculosis strains.
| CAS Number | 930470-97-6 |
| Synonyms | 2-chloro-4-fluoro-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]benzamide |
| Molecular Formula | C21H17ClFNO3 |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-4-fluoro-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]benzamide |
| InChI | InChI=1S/C21H17ClFNO3/c1-26-16-7-3-13(4-8-16)18-12-15(6-10-20(18)27-2)24-21(25)17-9-5-14(23)11-19(17)22/h3-12H,1-2H3,(H,24,25) |
| InChIKey | RWSCJEILSRMTEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=CC(=C2)NC(=O)C3=C(C=C(C=C3)F)Cl)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
