For research use only. Not for therapeutic Use.
DH-8P-DB (Cat No.: I040130) is a synthetic small molecule or compound that may be used in pharmaceutical research, potentially for targeting specific enzymes or cellular pathways involved in disease processes. The exact mechanism of action and therapeutic applications of DH-8P-DB are context-dependent, but compounds with similar structures are often designed to modulate protein functions, receptor activity, or enzyme inhibition. DH-8P-DB could be involved in cancer research, inflammatory diseases, or other therapeutic areas, though further studies would be needed to fully understand its efficacy and potential clinical applications.
CAS Number | 1054549-71-1 |
Synonyms | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(E)-2-phenylethenyl]-2,3-dihydrochromen-4-one |
Molecular Formula | C23H18O5 |
Purity | ≥95% |
InChI | InChI=1S/C23H18O5/c24-16-9-7-15(8-10-16)21-13-20(27)22-19(26)12-18(25)17(23(22)28-21)11-6-14-4-2-1-3-5-14/h1-12,21,24-26H,13H2/b11-6+ |
InChIKey | CCIHCBLYXNADJC-IZZDOVSWSA-N |
SMILES | C1C(OC2=C(C(=CC(=C2C1=O)O)O)C=CC3=CC=CC=C3)C4=CC=C(C=C4)O |
Reference | [1]. Zang R, et al. Microwell bioreactor system for cell-based high throughput proliferation and cytotoxicity assays[J]. Process Biochemistry, 2013, 48(1): 78-88. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |