For research use only. Not for therapeutic Use.
DH-8P-DB is an anticancer candidate and exhibits cytotoxicity against colon cancer cells[1].
| Catalog Number | I040130 |
| CAS Number | 1054549-71-1 |
| Synonyms | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(E)-2-phenylethenyl]-2,3-dihydrochromen-4-one |
| Molecular Formula | C23H18O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C23H18O5/c24-16-9-7-15(8-10-16)21-13-20(27)22-19(26)12-18(25)17(23(22)28-21)11-6-14-4-2-1-3-5-14/h1-12,21,24-26H,13H2/b11-6+ |
| InChIKey | CCIHCBLYXNADJC-IZZDOVSWSA-N |
| SMILES | C1C(OC2=C(C(=CC(=C2C1=O)O)O)C=CC3=CC=CC=C3)C4=CC=C(C=C4)O |
| Reference | [1]. Zang R, et al. Microwell bioreactor system for cell-based high throughput proliferation and cytotoxicity assays[J]. Process Biochemistry, 2013, 48(1): 78-88. |
