For research use only. Not for therapeutic Use.
Di-(2-ethylhexyl)peroxydicarbonate(Cat No.:M074111), commonly known as di(2-ethylhexyl)peroxydicarbonate or DEHPC, is an organic peroxide compound extensively used as a radical initiator in polymerization reactions. Its chemical structure features two peroxydicarbonate functional groups (-CO3-) bound to two 2-ethylhexyl groups. DEHPC acts as a source of free radicals, initiating the polymerization of unsaturated monomers in the production of polymers like polyethylene and polypropylene. Additionally, it finds application in cross-linking reactions to modify polymer properties.
Catalog Number | M074111 |
CAS Number | 16111-62-9 |
Molecular Formula | C18H34O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate |
InChI | InChI=1S/C18H34O6/c1-5-9-11-15(7-3)13-21-17(19)23-24-18(20)22-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3 |
InChIKey | ZACVGCNKGYYQHA-UHFFFAOYSA-N |
SMILES | CCCCC(CC)COC(=O)OOC(=O)OCC(CC)CCCC |