For research use only. Not for therapeutic Use.
Di-2-Pyridyl Thionocarbonate(CAT: L046088) is a high-purity compound widely used in pharmaceutical and organic chemistry research. This thionocarbonate derivative, featuring two pyridyl groups, is a versatile reagent for selective functional group transformations, including thionation and activation reactions. Its unique chemical properties make it a valuable tool in the synthesis of bioactive molecules, advanced materials, and pharmaceutical intermediates. With reliable stability and reactivity, Di-2-Pyridyl Thionocarbonate supports innovative research in drug discovery, organic synthesis, and the development of novel compounds, providing researchers with precision and efficiency in their experimental applications.
| CAS Number | 96989-50-3 |
| Molecular Formula | C11H8N2O2S |
| Purity | ≥95% |
| IUPAC Name | dipyridin-2-yloxymethanethione |
| InChI | InChI=1S/C11H8N2O2S/c16-11(14-9-5-1-3-7-12-9)15-10-6-2-4-8-13-10/h1-8H |
| InChIKey | IKYOVSVBLHGFMA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC(=S)OC2=CC=CC=N2 |
