For research use only. Not for therapeutic Use.
Di-n-nonyl adipate（Cat No.:M070981）, also known as diisononyl adipate (DINA), is an ester compound derived from adipic acid and nonyl alcohol. It is a clear, colorless liquid with low volatility and high compatibility with various polymers and resins. DINA is primarily used as a plasticizer in the production of flexible polyvinyl chloride (PVC) products, such as wires and cables, automotive interiors, and medical devices. It imparts flexibility, durability, and resistance to heat and cold to PVC formulations, enhancing their performance and processing characteristics.
| Catalog Number | M070981 |
| CAS Number | 151-32-6 |
| Molecular Formula | C24H46O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | dinonyl hexanedioate |
| InChI | InChI=1S/C24H46O4/c1-3-5-7-9-11-13-17-21-27-23(25)19-15-16-20-24(26)28-22-18-14-12-10-8-6-4-2/h3-22H2,1-2H3 |
| InChIKey | WIYAGHSNPUBKDT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCCC |
