For research use only. Not for therapeutic Use.
L-(-)-Dibenzoyltartaric acid (Cat No.:R050149) is an organic chiral compound that can be used as organic intermediate and pharmaceutical intermediate, and is widely used for chiral splitting of amines in laboratory research and development process and chemical and pharmaceutical synthesis process.
| Catalog Number | R050149 |
| CAS Number | 2743-38-6 |
| Synonyms | (2R,3R)-2,3-Bis(benzoyloxy)butanedioic Acid; (-)-Di-O-benzoyl-L-tartaric Acid; (-)-O,O’-Dibenzoyl-(2R,3R)-tartaric Acid; (2R,3R)-2,3-Bis(benzoyloxy)succinic Acid; NSC 118224; NSC 338494; |
| Molecular Formula | C18H14O8 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | (2R,3R)-2,3-dibenzoyloxybutanedioic acid |
| InChI | InChI=1S/C18H14O8/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h1-10,13-14H,(H,19,20)(H,21,22)/t13-,14-/m1/s1 |
| InChIKey | YONLFQNRGZXBBF-ZIAGYGMSSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC(C(C(=O)O)OC(=O)C2=CC=CC=C2)C(=O)O |
